C17H16N6O3 — CID 60527028
N-[3-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]phenyl]pyridine-4-carboxamide (PubChem CID 60527028) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is N-[3-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]phenyl]pyridine-4-carboxamide.
| Compound Name | N-[3-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]phenyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60527028 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[3-[[(3-methyl-5-nitroimidazol-4-yl)amino]methyl]phenyl]pyridine-4-carboxamide |
| SMILES | Cn1cnc([N+](=O)[O-])c1NCc1cccc(NC(=O)c2ccncc2)c1 |
| InChI | InChI=1S/C17H16N6O3/c1-22-11-20-16(23(25)26)15(22)19-10-12-3-2-4-14(9-12)21-17(24)13-5-7-18-8-6-13/h2-9,11,19H,10H2,1H3,(H,21,24) |
| InChIKey | UEYZLFKAISIGRM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|