C18H27NO — CID 605280
2-cyclohexyl-4,4-diethyl-1,2-dihydro-3,1-benzoxazine (PubChem CID 605280) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 2-cyclohexyl-4,4-diethyl-1,2-dihydro-3,1-benzoxazine.
| Compound Name | 2-cyclohexyl-4,4-diethyl-1,2-dihydro-3,1-benzoxazine |
|---|---|
| PubChem CID | 605280 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-cyclohexyl-4,4-diethyl-1,2-dihydro-3,1-benzoxazine |
| SMILES | CCC1(CC)OC(C2CCCCC2)Nc2ccccc21 |
| InChI | InChI=1S/C18H27NO/c1-3-18(4-2)15-12-8-9-13-16(15)19-17(20-18)14-10-6-5-7-11-14/h8-9,12-14,17,19H,3-7,10-11H2,1-2H3 |
| InChIKey | BPHZJOCKIJAVOM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |