C19H17FN4O4 — CID 60528237
6-cyclopropyl-N-(2-fluoro-5-nitrophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 60528237) has the molecular formula C19H17FN4O4 and a molecular weight of 384.37 g/mol. Its IUPAC name is 6-cyclopropyl-N-(2-fluoro-5-nitrophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 6-cyclopropyl-N-(2-fluoro-5-nitrophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60528237 |
| Molecular Formula | C19H17FN4O4 |
| Molecular Weight | 384.37 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 6-cyclopropyl-N-(2-fluoro-5-nitrophenyl)-3-propan-2-yl-[1,2]oxazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)c1noc2nc(C3CC3)cc(C(=O)Nc3cc([N+](=O)[O-])ccc3F)c12 |
| InChI | InChI=1S/C19H17FN4O4/c1-9(2)17-16-12(8-14(10-3-4-10)22-19(16)28-23-17)18(25)21-15-7-11(24(26)27)5-6-13(15)20/h5-10H,3-4H2,1-2H3,(H,21,25) |
| InChIKey | UEPZLJXKSSWVPN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|