C12H11F3N2O2S2 — CID 60528483
N-(furan-2-ylmethyl)-2-(1,3-thiazol-2-ylsulfanyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 60528483) has the molecular formula C12H11F3N2O2S2 and a molecular weight of 336.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(1,3-thiazol-2-ylsulfanyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-(1,3-thiazol-2-ylsulfanyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 60528483 |
| Molecular Formula | C12H11F3N2O2S2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(1,3-thiazol-2-ylsulfanyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CSc1nccs1)N(Cc1ccco1)CC(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O2S2/c13-12(14,15)8-17(6-9-2-1-4-19-9)10(18)7-21-11-16-3-5-20-11/h1-5H,6-8H2 |
| InChIKey | HSVRDNDHMINTOL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|