About 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole
4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole (PubChem CID 60528753) has the molecular formula C15H16F2N2S
and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole |
| PubChem CID | 60528753 |
| Molecular Formula | C15H16F2N2S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole |
| SMILES | CC1CCCN(c2nc(-c3ccc(F)c(F)c3)cs2)C1 |
| InChI | InChI=1S/C15H16F2N2S/c1-10-3-2-6-19(8-10)15-18-14(9-20-15)11-4-5-12(16)13(17)7-11/h4-5,7,9-10H,2-3,6,8H2,1H3 |
| InChIKey | PABSIMKFKOXQJE-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole?
The IUPAC name of 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole (CID 60528753) is 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole.
What is the SMILES notation for 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole?
The canonical SMILES for 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole is CC1CCCN(c2nc(-c3ccc(F)c(F)c3)cs2)C1.
What is the InChIKey of 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole?
The InChIKey is PABSIMKFKOXQJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F2N2S/c1-10-3-2-6-19(8-10)15-18-14(9-20-15)11-4-5-12(16)13(17)7-11/h4-5,7,9-10H,2-3,6,8H2,1H3.
What are the key properties of 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole?
4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole has a molecular weight of 294.37 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-difluorophenyl)-2-(3-methylpiperidin-1-yl)-1,3-thiazole is sourced from PubChem (CID 60528753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).