About 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one
7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 60529111) has the molecular formula C19H15FN2OS
and a molecular weight of 338.41 g/mol. Its IUPAC name is 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
| PubChem CID | 60529111 |
| Molecular Formula | C19H15FN2OS |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | Cc1ccc(-c2nc(-c3cc4c(cc3F)NC(=O)CC4)cs2)cc1 |
| InChI | InChI=1S/C19H15FN2OS/c1-11-2-4-12(5-3-11)19-22-17(10-24-19)14-8-13-6-7-18(23)21-16(13)9-15(14)20/h2-5,8-10H,6-7H2,1H3,(H,21,23) |
| InChIKey | UEAJEJUWSOMHPI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one?
The IUPAC name of 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one (CID 60529111) is 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one.
What is the SMILES notation for 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one?
The canonical SMILES for 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one is Cc1ccc(-c2nc(-c3cc4c(cc3F)NC(=O)CC4)cs2)cc1.
What is the InChIKey of 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one?
The InChIKey is UEAJEJUWSOMHPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN2OS/c1-11-2-4-12(5-3-11)19-22-17(10-24-19)14-8-13-6-7-18(23)21-16(13)9-15(14)20/h2-5,8-10H,6-7H2,1H3,(H,21,23).
What are the key properties of 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one?
7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one has a molecular weight of 338.41 g/mol, XLogP of 4.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-6-[2-(4-methylphenyl)-1,3-thiazol-4-yl]-3,4-dihydro-1H-quinolin-2-one is sourced from PubChem (CID 60529111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).