C18H18FN3S — CID 60529871
5-(2-fluorophenyl)-3-(4-phenylbutan-2-ylsulfanyl)-1H-1,2,4-triazole (PubChem CID 60529871) has the molecular formula C18H18FN3S and a molecular weight of 327.43 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-3-(4-phenylbutan-2-ylsulfanyl)-1H-1,2,4-triazole.
| Compound Name | 5-(2-fluorophenyl)-3-(4-phenylbutan-2-ylsulfanyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 60529871 |
| Molecular Formula | C18H18FN3S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 5-(2-fluorophenyl)-3-(4-phenylbutan-2-ylsulfanyl)-1H-1,2,4-triazole |
| SMILES | CC(CCc1ccccc1)Sc1n[nH]c(-c2ccccc2F)n1 |
| InChI | InChI=1S/C18H18FN3S/c1-13(11-12-14-7-3-2-4-8-14)23-18-20-17(21-22-18)15-9-5-6-10-16(15)19/h2-10,13H,11-12H2,1H3,(H,20,21,22) |
| InChIKey | KCYNLBJXUPEKKF-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |