C21H27N3O5S — CID 60530226
2,3-dimethyl-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-5-nitrobenzenesulfonamide (PubChem CID 60530226) has the molecular formula C21H27N3O5S and a molecular weight of 433.53 g/mol. Its IUPAC name is 2,3-dimethyl-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-5-nitrobenzenesulfonamide.
| Compound Name | 2,3-dimethyl-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 60530226 |
| Molecular Formula | C21H27N3O5S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2,3-dimethyl-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]-5-nitrobenzenesulfonamide |
| SMILES | Cc1ccc(C(CNS(=O)(=O)c2cc([N+](=O)[O-])cc(C)c2C)N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H27N3O5S/c1-15-4-6-18(7-5-15)20(23-8-10-29-11-9-23)14-22-30(27,28)21-13-19(24(25)26)12-16(2)17(21)3/h4-7,12-13,20,22H,8-11,14H2,1-3H3 |
| InChIKey | ZHAXXRZCSLXTJH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|