About 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one
2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one (PubChem CID 605308) has the molecular formula C12H12Cl3NO2
and a molecular weight of 308.59 g/mol. Its IUPAC name is 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one.
Molecular Properties
| Compound Name | 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one |
| PubChem CID | 605308 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one |
| SMILES | Cc1cc(C)c2c(c1)OC(N)(C(Cl)(Cl)Cl)CC2=O |
| InChI | InChI=1S/C12H12Cl3NO2/c1-6-3-7(2)10-8(17)5-11(16,12(13,14)15)18-9(10)4-6/h3-4H,5,16H2,1-2H3 |
| InChIKey | SUXXSHIJUBVHBQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one?
The IUPAC name of 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one (CID 605308) is 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one.
What is the SMILES notation for 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one?
The canonical SMILES for 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one is Cc1cc(C)c2c(c1)OC(N)(C(Cl)(Cl)Cl)CC2=O.
What is the InChIKey of 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one?
The InChIKey is SUXXSHIJUBVHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Cl3NO2/c1-6-3-7(2)10-8(17)5-11(16,12(13,14)15)18-9(10)4-6/h3-4H,5,16H2,1-2H3.
What are the key properties of 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one?
2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one has a molecular weight of 308.59 g/mol, XLogP of 3.29, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-5,7-dimethyl-2-(trichloromethyl)-3H-chromen-4-one is sourced from PubChem (CID 605308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).