About Noberastine
Noberastine (PubChem CID 60531) has the molecular formula C17H21N5O
and a molecular weight of 311.40 g/mol. Its IUPAC name is 3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | Noberastine |
| PubChem CID | 60531 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine |
| SMILES | CC1=CC=C(O1)CN2C3=C(C=CC=N3)N=C2NC4CCNCC4 |
| InChI | InChI=1S/C17H21N5O/c1-12-4-5-14(23-12)11-22-16-15(3-2-8-19-16)21-17(22)20-13-6-9-18-10-7-13/h2-5,8,13,18H,6-7,9-11H2,1H3,(H,20,21) |
| InChIKey | VNIOQSAWKLOGLY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 389 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Noberastine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Noberastine?
The IUPAC name of Noberastine (CID 60531) is 3-[(5-methylfuran-2-yl)methyl]-N-piperidin-4-ylimidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for Noberastine?
The canonical SMILES for Noberastine is CC1=CC=C(O1)CN2C3=C(C=CC=N3)N=C2NC4CCNCC4.
What is the InChIKey of Noberastine?
The InChIKey is VNIOQSAWKLOGLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O/c1-12-4-5-14(23-12)11-22-16-15(3-2-8-19-16)21-17(22)20-13-6-9-18-10-7-13/h2-5,8,13,18H,6-7,9-11H2,1H3,(H,20,21).
What are the key properties of Noberastine?
Noberastine has a molecular weight of 311.40 g/mol, XLogP of 2.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Noberastine is sourced from PubChem (CID 60531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).