C26H25N5O2 — CID 60531850
N-[3-(3-cyanopropoxy)phenyl]-6-phenyl-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 60531850) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[3-(3-cyanopropoxy)phenyl]-6-phenyl-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-[3-(3-cyanopropoxy)phenyl]-6-phenyl-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 60531850 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[3-(3-cyanopropoxy)phenyl]-6-phenyl-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | CC(C)n1ncc2c(C(=O)Nc3cccc(OCCCC#N)c3)cc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C26H25N5O2/c1-18(2)31-25-23(17-28-31)22(16-24(30-25)19-9-4-3-5-10-19)26(32)29-20-11-8-12-21(15-20)33-14-7-6-13-27/h3-5,8-12,15-18H,6-7,14H2,1-2H3,(H,29,32) |
| InChIKey | YXSZSRIUPHJFJR-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|