C19H19ClN4O3S — CID 60532227
N-[3-[(3-chloro-2-methylphenyl)sulfonylamino]phenyl]-2-pyrazol-1-ylpropanamide (PubChem CID 60532227) has the molecular formula C19H19ClN4O3S and a molecular weight of 418.91 g/mol. Its IUPAC name is N-[3-[(3-chloro-2-methylphenyl)sulfonylamino]phenyl]-2-pyrazol-1-ylpropanamide.
| Compound Name | N-[3-[(3-chloro-2-methylphenyl)sulfonylamino]phenyl]-2-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 60532227 |
| Molecular Formula | C19H19ClN4O3S |
| Molecular Weight | 418.91 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | N-[3-[(3-chloro-2-methylphenyl)sulfonylamino]phenyl]-2-pyrazol-1-ylpropanamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1cccc(NC(=O)C(C)n2cccn2)c1 |
| InChI | InChI=1S/C19H19ClN4O3S/c1-13-17(20)8-4-9-18(13)28(26,27)23-16-7-3-6-15(12-16)22-19(25)14(2)24-11-5-10-21-24/h3-12,14,23H,1-2H3,(H,22,25) |
| InChIKey | RUGILXUIBCPQJO-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.91 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |