About 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide
3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide (PubChem CID 60532632) has the molecular formula C19H26N2O4S2
and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide |
| PubChem CID | 60532632 |
| Molecular Formula | C19H26N2O4S2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)Nc2cccc(C(C)C)c2)c(C)c1NS(C)(=O)=O |
| InChI | InChI=1S/C19H26N2O4S2/c1-12(2)16-8-7-9-17(11-16)20-27(24,25)19-14(4)10-13(3)18(15(19)5)21-26(6,22)23/h7-12,20-21H,1-6H3 |
| InChIKey | KZKNXJLRNSIMPH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide?
The IUPAC name of 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide (CID 60532632) is 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide.
What is the SMILES notation for 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide?
The canonical SMILES for 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide is Cc1cc(C)c(S(=O)(=O)Nc2cccc(C(C)C)c2)c(C)c1NS(C)(=O)=O.
What is the InChIKey of 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide?
The InChIKey is KZKNXJLRNSIMPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O4S2/c1-12(2)16-8-7-9-17(11-16)20-27(24,25)19-14(4)10-13(3)18(15(19)5)21-26(6,22)23/h7-12,20-21H,1-6H3.
What are the key properties of 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide?
3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide has a molecular weight of 410.56 g/mol, XLogP of 3.91, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methanesulfonamido)-2,4,6-trimethyl-N-(3-propan-2-ylphenyl)benzenesulfonamide is sourced from PubChem (CID 60532632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).