About (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide
(E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide (PubChem CID 60532924) has the molecular formula C15H13F2NO2S
and a molecular weight of 309.34 g/mol. Its IUPAC name is (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide.
Molecular Properties
| Compound Name | (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide |
| PubChem CID | 60532924 |
| Molecular Formula | C15H13F2NO2S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide |
| SMILES | Cc1ccc(/C=C/S(=O)(=O)Nc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C15H13F2NO2S/c1-11-5-7-12(8-6-11)9-10-21(19,20)18-15-13(16)3-2-4-14(15)17/h2-10,18H,1H3/b10-9+ |
| InChIKey | FRDBLIGLACSACF-MDZDMXLPSA-N |
| XLogP | 3.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide?
The IUPAC name of (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide (CID 60532924) is (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide.
What is the SMILES notation for (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide?
The canonical SMILES for (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide is Cc1ccc(/C=C/S(=O)(=O)Nc2c(F)cccc2F)cc1.
What is the InChIKey of (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide?
The InChIKey is FRDBLIGLACSACF-MDZDMXLPSA-N. The full InChI is InChI=1S/C15H13F2NO2S/c1-11-5-7-12(8-6-11)9-10-21(19,20)18-15-13(16)3-2-4-14(15)17/h2-10,18H,1H3/b10-9+.
What are the key properties of (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide?
(E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide has a molecular weight of 309.34 g/mol, XLogP of 3.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(2,6-difluorophenyl)-2-(4-methylphenyl)ethenesulfonamide is sourced from PubChem (CID 60532924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).