C21H9F20NO7 — CID 605340
[4-[2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 605340) has the molecular formula C21H9F20NO7 and a molecular weight of 767.26 g/mol. Its IUPAC name is [4-[2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 605340 |
| Molecular Formula | C21H9F20NO7 |
| Molecular Weight | 767.26 g/mol |
| Exact Mass | 767.01 |
| IUPAC Name | [4-[2-[methyl(2,2,3,3,3-pentafluoropropanoyl)amino]-1-(2,2,3,3,3-pentafluoropropanoyloxy)ethyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CN(CC(OC(=O)C(F)(F)C(F)(F)F)c1ccc(OC(=O)C(F)(F)C(F)(F)F)c(OC(=O)C(F)(F)C(F)(F)F)c1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H9F20NO7/c1-42(10(43)14(22,23)18(30,31)32)5-9(49-13(46)17(28,29)21(39,40)41)6-2-3-7(47-11(44)15(24,25)19(33,34)35)8(4-6)48-12(45)16(26,27)20(36,37)38/h2-4,9H,5H2,1H3 |
| InChIKey | DQHPORNTYPSWLW-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.26 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|