C14Cl10 — CID 605342
1,2,3,4,5,6,7,8,9,10-decachlorophenanthrene (PubChem CID 605342) has the molecular formula C14Cl10 and a molecular weight of 522.68 g/mol. Its IUPAC name is 1,2,3,4,5,6,7,8,9,10-decachlorophenanthrene.
| Compound Name | 1,2,3,4,5,6,7,8,9,10-decachlorophenanthrene |
|---|---|
| PubChem CID | 605342 |
| Molecular Formula | C14Cl10 |
| Molecular Weight | 522.68 g/mol |
| Exact Mass | 517.69 |
| IUPAC Name | 1,2,3,4,5,6,7,8,9,10-decachlorophenanthrene |
| SMILES | Clc1c(Cl)c(Cl)c2c(c1Cl)c(Cl)c(Cl)c1c(Cl)c(Cl)c(Cl)c(Cl)c12 |
| InChI | InChI=1S/C14Cl10/c15-5-1-2-4(10(20)14(24)12(22)6(2)16)8(18)7(17)3(1)9(19)13(23)11(5)21 |
| InChIKey | AGUQSHNDMREDCR-UHFFFAOYSA-N |
| XLogP | 10.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.68 |
| LogP ≤ 5 | 10.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|