C16H17FN2O4S — CID 60534530
ethyl N-[4-[(3-fluoro-4-methylphenyl)sulfonylamino]phenyl]carbamate (PubChem CID 60534530) has the molecular formula C16H17FN2O4S and a molecular weight of 352.39 g/mol. Its IUPAC name is ethyl N-[4-[(3-fluoro-4-methylphenyl)sulfonylamino]phenyl]carbamate.
| Compound Name | ethyl N-[4-[(3-fluoro-4-methylphenyl)sulfonylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 60534530 |
| Molecular Formula | C16H17FN2O4S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | ethyl N-[4-[(3-fluoro-4-methylphenyl)sulfonylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C)c(F)c2)cc1 |
| InChI | InChI=1S/C16H17FN2O4S/c1-3-23-16(20)18-12-5-7-13(8-6-12)19-24(21,22)14-9-4-11(2)15(17)10-14/h4-10,19H,3H2,1-2H3,(H,18,20) |
| InChIKey | OFPUVCFUXSWTMC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |