About methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate
methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (PubChem CID 60534669) has the molecular formula C17H17NO4S
and a molecular weight of 331.39 g/mol. Its IUPAC name is methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| PubChem CID | 60534669 |
| Molecular Formula | C17H17NO4S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CC(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO4S/c1-12-11-18(16-6-4-3-5-15(12)16)23(20,21)14-9-7-13(8-10-14)17(19)22-2/h3-10,12H,11H2,1-2H3 |
| InChIKey | WEZNXXAWIVXMTB-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
The IUPAC name of methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate (CID 60534669) is methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate.
What is the SMILES notation for methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
The canonical SMILES for methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate is COC(=O)c1ccc(S(=O)(=O)N2CC(C)c3ccccc32)cc1.
What is the InChIKey of methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
The InChIKey is WEZNXXAWIVXMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17NO4S/c1-12-11-18(16-6-4-3-5-15(12)16)23(20,21)14-9-7-13(8-10-14)17(19)22-2/h3-10,12H,11H2,1-2H3.
What are the key properties of methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate?
methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate has a molecular weight of 331.39 g/mol, XLogP of 2.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]benzoate is sourced from PubChem (CID 60534669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).