About 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline
8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline (PubChem CID 60534849) has the molecular formula C18H15FN2O2S
and a molecular weight of 342.40 g/mol. Its IUPAC name is 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline.
Molecular Properties
| Compound Name | 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline |
| PubChem CID | 60534849 |
| Molecular Formula | C18H15FN2O2S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline |
| SMILES | CC1CN(S(=O)(=O)c2ccc(F)c3ncccc23)c2ccccc21 |
| InChI | InChI=1S/C18H15FN2O2S/c1-12-11-21(16-7-3-2-5-13(12)16)24(22,23)17-9-8-15(19)18-14(17)6-4-10-20-18/h2-10,12H,11H2,1H3 |
| InChIKey | BLGBWLIGABAJRI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline?
The IUPAC name of 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline (CID 60534849) is 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline.
What is the SMILES notation for 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline?
The canonical SMILES for 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline is CC1CN(S(=O)(=O)c2ccc(F)c3ncccc23)c2ccccc21.
What is the InChIKey of 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline?
The InChIKey is BLGBWLIGABAJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O2S/c1-12-11-21(16-7-3-2-5-13(12)16)24(22,23)17-9-8-15(19)18-14(17)6-4-10-20-18/h2-10,12H,11H2,1H3.
What are the key properties of 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline?
8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline has a molecular weight of 342.40 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-5-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]quinoline is sourced from PubChem (CID 60534849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).