C26H27N5O2S — CID 60536314
N-[4-[benzyl(methyl)amino]phenyl]-2-[[4-(4-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 60536314) has the molecular formula C26H27N5O2S and a molecular weight of 473.60 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)amino]phenyl]-2-[[4-(4-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[4-[benzyl(methyl)amino]phenyl]-2-[[4-(4-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 60536314 |
| Molecular Formula | C26H27N5O2S |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[4-[benzyl(methyl)amino]phenyl]-2-[[4-(4-methoxyphenyl)-5-methyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | COc1ccc(-n2c(C)nnc2SCC(=O)Nc2ccc(N(C)Cc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C26H27N5O2S/c1-19-28-29-26(31(19)23-13-15-24(33-3)16-14-23)34-18-25(32)27-21-9-11-22(12-10-21)30(2)17-20-7-5-4-6-8-20/h4-16H,17-18H2,1-3H3,(H,27,32) |
| InChIKey | BQTXRYLOOCRTMC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|