C26H27FN4O2 — CID 60536969
N-[2-fluoro-5-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]phenyl]-2-phenylacetamide (PubChem CID 60536969) has the molecular formula C26H27FN4O2 and a molecular weight of 446.53 g/mol. Its IUPAC name is N-[2-fluoro-5-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]phenyl]-2-phenylacetamide.
| Compound Name | N-[2-fluoro-5-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 60536969 |
| Molecular Formula | C26H27FN4O2 |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[2-fluoro-5-[[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl]amino]phenyl]-2-phenylacetamide |
| SMILES | O=C(CNc1ccc(F)c(NC(=O)Cc2ccccc2)c1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C26H27FN4O2/c27-23-13-10-21(17-24(23)30-25(32)16-19-6-2-1-3-7-19)28-18-26(33)29-20-8-11-22(12-9-20)31-14-4-5-15-31/h1-3,6-13,17,28H,4-5,14-16,18H2,(H,29,33)(H,30,32) |
| InChIKey | KYCULFOXWMRLJQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|