About 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide
2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide (PubChem CID 6053740) has the molecular formula C8H8F3N3O2
and a molecular weight of 235.16 g/mol. Its IUPAC name is 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide.
Molecular Properties
| Compound Name | 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide |
| PubChem CID | 6053740 |
| Molecular Formula | C8H8F3N3O2 |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide |
| SMILES | C/C(CC(=O)C(F)(F)F)=N\NC(=O)CC#N |
| InChI | InChI=1S/C8H8F3N3O2/c1-5(4-6(15)8(9,10)11)13-14-7(16)2-3-12/h2,4H2,1H3,(H,14,16)/b13-5+ |
| InChIKey | SDGRECJRTKVUOW-WLRTZDKTSA-N |
| XLogP | 0.91 |
| TPSA | 82.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide?
The IUPAC name of 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide (CID 6053740) is 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide.
What is the SMILES notation for 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide?
The canonical SMILES for 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide is C/C(CC(=O)C(F)(F)F)=N\NC(=O)CC#N.
What is the InChIKey of 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide?
The InChIKey is SDGRECJRTKVUOW-WLRTZDKTSA-N. The full InChI is InChI=1S/C8H8F3N3O2/c1-5(4-6(15)8(9,10)11)13-14-7(16)2-3-12/h2,4H2,1H3,(H,14,16)/b13-5+.
What are the key properties of 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide?
2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide has a molecular weight of 235.16 g/mol, XLogP of 0.91, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-[(E)-(5,5,5-trifluoro-4-oxopentan-2-ylidene)amino]acetamide is sourced from PubChem (CID 6053740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).