C21H39N3O — CID 60538233
1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(3,3-dimethylbutyl)piperazin-1-yl]ethanone (PubChem CID 60538233) has the molecular formula C21H39N3O and a molecular weight of 349.56 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(3,3-dimethylbutyl)piperazin-1-yl]ethanone.
| Compound Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(3,3-dimethylbutyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 60538233 |
| Molecular Formula | C21H39N3O |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | 1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-[4-(3,3-dimethylbutyl)piperazin-1-yl]ethanone |
| SMILES | CC(C)(C)CCN1CCN(CC(=O)N2CCCC3CCCCC32)CC1 |
| InChI | InChI=1S/C21H39N3O/c1-21(2,3)10-12-22-13-15-23(16-14-22)17-20(25)24-11-6-8-18-7-4-5-9-19(18)24/h18-19H,4-17H2,1-3H3 |
| InChIKey | LJCIBGXGHYGCQN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |