About [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone
[1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone (PubChem CID 60541380) has the molecular formula C22H21FN2O3
and a molecular weight of 380.42 g/mol. Its IUPAC name is [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone |
| PubChem CID | 60541380 |
| Molecular Formula | C22H21FN2O3 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CCN(C(=O)C2CC(c3cccc(F)c3)=NO2)CC1 |
| InChI | InChI=1S/C22H21FN2O3/c23-18-8-4-7-17(13-18)19-14-20(28-24-19)22(27)25-11-9-16(10-12-25)21(26)15-5-2-1-3-6-15/h1-8,13,16,20H,9-12,14H2 |
| InChIKey | KOPJQEQKRXBGQD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone?
The IUPAC name of [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone (CID 60541380) is [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone.
What is the SMILES notation for [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone?
The canonical SMILES for [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone is O=C(c1ccccc1)C1CCN(C(=O)C2CC(c3cccc(F)c3)=NO2)CC1.
What is the InChIKey of [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone?
The InChIKey is KOPJQEQKRXBGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN2O3/c23-18-8-4-7-17(13-18)19-14-20(28-24-19)22(27)25-11-9-16(10-12-25)21(26)15-5-2-1-3-6-15/h1-8,13,16,20H,9-12,14H2.
What are the key properties of [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone?
[1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone has a molecular weight of 380.42 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(3-fluorophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]piperidin-4-yl]-phenylmethanone is sourced from PubChem (CID 60541380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).