About 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate
2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate (PubChem CID 60541822) has the molecular formula C15H11F3N6O4
and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate |
| PubChem CID | 60541822 |
| Molecular Formula | C15H11F3N6O4 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate |
| SMILES | O=C(OCCc1cn[nH]c1C(F)(F)F)c1ccc(-n2cncn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H11F3N6O4/c16-15(17,18)13-10(6-20-22-13)3-4-28-14(25)9-1-2-11(12(5-9)24(26)27)23-8-19-7-21-23/h1-2,5-8H,3-4H2,(H,20,22) |
| InChIKey | NJXBSLBBUIRINL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 128.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate?
The IUPAC name of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate (CID 60541822) is 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate.
What is the SMILES notation for 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate?
The canonical SMILES for 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate is O=C(OCCc1cn[nH]c1C(F)(F)F)c1ccc(-n2cncn2)c([N+](=O)[O-])c1.
What is the InChIKey of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate?
The InChIKey is NJXBSLBBUIRINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F3N6O4/c16-15(17,18)13-10(6-20-22-13)3-4-28-14(25)9-1-2-11(12(5-9)24(26)27)23-8-19-7-21-23/h1-2,5-8H,3-4H2,(H,20,22).
What are the key properties of 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate?
2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate has a molecular weight of 396.29 g/mol, XLogP of 2.32, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-1H-pyrazol-4-yl]ethyl 3-nitro-4-(1,2,4-triazol-1-yl)benzoate is sourced from PubChem (CID 60541822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).