About N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide
N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide (PubChem CID 60542182) has the molecular formula C17H25NO2S
and a molecular weight of 307.46 g/mol. Its IUPAC name is N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide |
| PubChem CID | 60542182 |
| Molecular Formula | C17H25NO2S |
| Molecular Weight | 307.46 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide |
| SMILES | Cc1cc(C)cc(OCCCSC(C)C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C17H25NO2S/c1-12-9-13(2)11-16(10-12)20-7-4-8-21-14(3)17(19)18-15-5-6-15/h9-11,14-15H,4-8H2,1-3H3,(H,18,19) |
| InChIKey | HDFGLYJXXNORBC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide?
The IUPAC name of N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide (CID 60542182) is N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide.
What is the SMILES notation for N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide?
The canonical SMILES for N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide is Cc1cc(C)cc(OCCCSC(C)C(=O)NC2CC2)c1.
What is the InChIKey of N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide?
The InChIKey is HDFGLYJXXNORBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO2S/c1-12-9-13(2)11-16(10-12)20-7-4-8-21-14(3)17(19)18-15-5-6-15/h9-11,14-15H,4-8H2,1-3H3,(H,18,19).
What are the key properties of N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide?
N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide has a molecular weight of 307.46 g/mol, XLogP of 3.47, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-[3-(3,5-dimethylphenoxy)propylsulfanyl]propanamide is sourced from PubChem (CID 60542182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).