C25H23FN4O3 — CID 60542267
3-fluoro-N-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenyl]benzamide (PubChem CID 60542267) has the molecular formula C25H23FN4O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is 3-fluoro-N-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 60542267 |
| Molecular Formula | C25H23FN4O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3-fluoro-N-[2-methoxy-5-[1-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethylamino]phenyl]benzamide |
| SMILES | COc1ccc(NC(C)c2nnc(-c3ccc(C)cc3)o2)cc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C25H23FN4O3/c1-15-7-9-17(10-8-15)25-30-29-24(33-25)16(2)27-20-11-12-22(32-3)21(14-20)28-23(31)18-5-4-6-19(26)13-18/h4-14,16,27H,1-3H3,(H,28,31) |
| InChIKey | FZVILNPLQRTHGX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|