C18H20F2N2O2 — CID 60543351
1-(3,5-difluoro-4-methoxyphenyl)-3-(4-phenylbutan-2-yl)urea (PubChem CID 60543351) has the molecular formula C18H20F2N2O2 and a molecular weight of 334.37 g/mol. Its IUPAC name is 1-(3,5-difluoro-4-methoxyphenyl)-3-(4-phenylbutan-2-yl)urea.
| Compound Name | 1-(3,5-difluoro-4-methoxyphenyl)-3-(4-phenylbutan-2-yl)urea |
|---|---|
| PubChem CID | 60543351 |
| Molecular Formula | C18H20F2N2O2 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(3,5-difluoro-4-methoxyphenyl)-3-(4-phenylbutan-2-yl)urea |
| SMILES | COc1c(F)cc(NC(=O)NC(C)CCc2ccccc2)cc1F |
| InChI | InChI=1S/C18H20F2N2O2/c1-12(8-9-13-6-4-3-5-7-13)21-18(23)22-14-10-15(19)17(24-2)16(20)11-14/h3-7,10-12H,8-9H2,1-2H3,(H2,21,22,23) |
| InChIKey | HGJGWSHOMUYATC-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |