C21H25BrN2O3 — CID 60543526
5-bromo-N-[4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]phenyl]furan-2-carboxamide (PubChem CID 60543526) has the molecular formula C21H25BrN2O3 and a molecular weight of 433.35 g/mol. Its IUPAC name is 5-bromo-N-[4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60543526 |
| Molecular Formula | C21H25BrN2O3 |
| Molecular Weight | 433.35 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 5-bromo-N-[4-[2-[cyclohexyl(ethyl)amino]-2-oxoethyl]phenyl]furan-2-carboxamide |
| SMILES | CCN(C(=O)Cc1ccc(NC(=O)c2ccc(Br)o2)cc1)C1CCCCC1 |
| InChI | InChI=1S/C21H25BrN2O3/c1-2-24(17-6-4-3-5-7-17)20(25)14-15-8-10-16(11-9-15)23-21(26)18-12-13-19(22)27-18/h8-13,17H,2-7,14H2,1H3,(H,23,26) |
| InChIKey | RLZKBCRNFISTGR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.35 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |