C16H22N2O4S — CID 60545522
1-(4-ethylphenyl)-N-(2-methylsulfonylethyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 60545522) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-N-(2-methylsulfonylethyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-ethylphenyl)-N-(2-methylsulfonylethyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 60545522 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 1-(4-ethylphenyl)-N-(2-methylsulfonylethyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCc1ccc(N2CC(C(=O)NCCS(C)(=O)=O)CC2=O)cc1 |
| InChI | InChI=1S/C16H22N2O4S/c1-3-12-4-6-14(7-5-12)18-11-13(10-15(18)19)16(20)17-8-9-23(2,21)22/h4-7,13H,3,8-11H2,1-2H3,(H,17,20) |
| InChIKey | AEEJHLMBPHHICK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |