C19H26N2O2S2 — CID 60546139
N-(1,3-benzothiazol-2-yl)-2-butylsulfanyl-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 60546139) has the molecular formula C19H26N2O2S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-butylsulfanyl-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-butylsulfanyl-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 60546139 |
| Molecular Formula | C19H26N2O2S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-butylsulfanyl-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | CCCCSC(C)C(=O)N(CC1CCCO1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H26N2O2S2/c1-3-4-12-24-14(2)18(22)21(13-15-8-7-11-23-15)19-20-16-9-5-6-10-17(16)25-19/h5-6,9-10,14-15H,3-4,7-8,11-13H2,1-2H3 |
| InChIKey | GSCJWMUJQDZOOM-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|