C17H29N3O2S2 — CID 60546760
2-butylsulfanyl-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide (PubChem CID 60546760) has the molecular formula C17H29N3O2S2 and a molecular weight of 371.57 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 60546760 |
| Molecular Formula | C17H29N3O2S2 |
| Molecular Weight | 371.57 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-butylsulfanyl-N-[4-[(2,6-dimethylmorpholin-4-yl)methyl]-1,3-thiazol-2-yl]propanamide |
| SMILES | CCCCSC(C)C(=O)Nc1nc(CN2CC(C)OC(C)C2)cs1 |
| InChI | InChI=1S/C17H29N3O2S2/c1-5-6-7-23-14(4)16(21)19-17-18-15(11-24-17)10-20-8-12(2)22-13(3)9-20/h11-14H,5-10H2,1-4H3,(H,18,19,21) |
| InChIKey | BDRNPZNAOIJEQD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|