C16H11Cl3N4O2 — CID 60548231
8-methyl-4-oxo-N'-(2,4,6-trichlorophenyl)pyrido[1,2-a]pyrimidine-3-carbohydrazide (PubChem CID 60548231) has the molecular formula C16H11Cl3N4O2 and a molecular weight of 397.65 g/mol. Its IUPAC name is 8-methyl-4-oxo-N'-(2,4,6-trichlorophenyl)pyrido[1,2-a]pyrimidine-3-carbohydrazide.
| Compound Name | 8-methyl-4-oxo-N'-(2,4,6-trichlorophenyl)pyrido[1,2-a]pyrimidine-3-carbohydrazide |
|---|---|
| PubChem CID | 60548231 |
| Molecular Formula | C16H11Cl3N4O2 |
| Molecular Weight | 397.65 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 8-methyl-4-oxo-N'-(2,4,6-trichlorophenyl)pyrido[1,2-a]pyrimidine-3-carbohydrazide |
| SMILES | Cc1ccn2c(=O)c(C(=O)NNc3c(Cl)cc(Cl)cc3Cl)cnc2c1 |
| InChI | InChI=1S/C16H11Cl3N4O2/c1-8-2-3-23-13(4-8)20-7-10(16(23)25)15(24)22-21-14-11(18)5-9(17)6-12(14)19/h2-7,21H,1H3,(H,22,24) |
| InChIKey | OZZMLFNPEWLXBT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|