C18H21BrN4O3 — CID 60548387
N-(5-bromo-2-pyridinyl)-1-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 60548387) has the molecular formula C18H21BrN4O3 and a molecular weight of 421.30 g/mol. Its IUPAC name is N-(5-bromo-2-pyridinyl)-1-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | N-(5-bromo-2-pyridinyl)-1-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 60548387 |
| Molecular Formula | C18H21BrN4O3 |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | N-(5-bromo-2-pyridinyl)-1-[2-(furan-2-ylmethylamino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | O=C(CN1CCC(C(=O)Nc2ccc(Br)cn2)CC1)NCc1ccco1 |
| InChI | InChI=1S/C18H21BrN4O3/c19-14-3-4-16(20-10-14)22-18(25)13-5-7-23(8-6-13)12-17(24)21-11-15-2-1-9-26-15/h1-4,9-10,13H,5-8,11-12H2,(H,21,24)(H,20,22,25) |
| InChIKey | RRHOSKLFPNAYEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |