About (3-fluorophenyl) pyridine-3-sulfonate
(3-fluorophenyl) pyridine-3-sulfonate (PubChem CID 60548517) has the molecular formula C11H8FNO3S
and a molecular weight of 253.25 g/mol. Its IUPAC name is (3-fluorophenyl) pyridine-3-sulfonate.
Molecular Properties
| Compound Name | (3-fluorophenyl) pyridine-3-sulfonate |
| PubChem CID | 60548517 |
| Molecular Formula | C11H8FNO3S |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | (3-fluorophenyl) pyridine-3-sulfonate |
| SMILES | O=S(=O)(Oc1cccc(F)c1)c1cccnc1 |
| InChI | InChI=1S/C11H8FNO3S/c12-9-3-1-4-10(7-9)16-17(14,15)11-5-2-6-13-8-11/h1-8H |
| InChIKey | WJDKAEHUGMEJRR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-fluorophenyl) pyridine-3-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-fluorophenyl) pyridine-3-sulfonate?
The IUPAC name of (3-fluorophenyl) pyridine-3-sulfonate (CID 60548517) is (3-fluorophenyl) pyridine-3-sulfonate.
What is the SMILES notation for (3-fluorophenyl) pyridine-3-sulfonate?
The canonical SMILES for (3-fluorophenyl) pyridine-3-sulfonate is O=S(=O)(Oc1cccc(F)c1)c1cccnc1.
What is the InChIKey of (3-fluorophenyl) pyridine-3-sulfonate?
The InChIKey is WJDKAEHUGMEJRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO3S/c12-9-3-1-4-10(7-9)16-17(14,15)11-5-2-6-13-8-11/h1-8H.
What are the key properties of (3-fluorophenyl) pyridine-3-sulfonate?
(3-fluorophenyl) pyridine-3-sulfonate has a molecular weight of 253.25 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-fluorophenyl) pyridine-3-sulfonate is sourced from PubChem (CID 60548517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).