C16H19N3OS — CID 60548570
1-benzyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide (PubChem CID 60548570) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-benzyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 60548570 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 1-benzyl-N-(1,3-thiazol-2-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H19N3OS/c20-15(18-16-17-8-10-21-16)14-7-4-9-19(12-14)11-13-5-2-1-3-6-13/h1-3,5-6,8,10,14H,4,7,9,11-12H2,(H,17,18,20) |
| InChIKey | BVWQRWVHDQMUAA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |