About 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide
2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide (PubChem CID 60549641) has the molecular formula C14H10FN3O2S3
and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide |
| PubChem CID | 60549641 |
| Molecular Formula | C14H10FN3O2S3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Sc2nncs2)cc1)c1ccccc1F |
| InChI | InChI=1S/C14H10FN3O2S3/c15-12-3-1-2-4-13(12)23(19,20)18-10-5-7-11(8-6-10)22-14-17-16-9-21-14/h1-9,18H |
| InChIKey | JNBHGJWJGOSWLU-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide?
The IUPAC name of 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide (CID 60549641) is 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide.
What is the SMILES notation for 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide?
The canonical SMILES for 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide is O=S(=O)(Nc1ccc(Sc2nncs2)cc1)c1ccccc1F.
What is the InChIKey of 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide?
The InChIKey is JNBHGJWJGOSWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O2S3/c15-12-3-1-2-4-13(12)23(19,20)18-10-5-7-11(8-6-10)22-14-17-16-9-21-14/h1-9,18H.
What are the key properties of 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide?
2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide has a molecular weight of 367.45 g/mol, XLogP of 3.63, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N-[4-(1,3,4-thiadiazol-2-ylsulfanyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 60549641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).