About 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide
4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide (PubChem CID 60549753) has the molecular formula C15H17FN4O3
and a molecular weight of 320.32 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide.
Molecular Properties
| Compound Name | 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide |
| PubChem CID | 60549753 |
| Molecular Formula | C15H17FN4O3 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide |
| SMILES | COc1ccnc(NNC(=O)CCCOc2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H17FN4O3/c1-22-14-7-8-17-15(18-14)20-19-13(21)6-3-9-23-12-5-2-4-11(16)10-12/h2,4-5,7-8,10H,3,6,9H2,1H3,(H,19,21)(H,17,18,20) |
| InChIKey | PWGYGVNSSZSPOY-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide?
The IUPAC name of 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide (CID 60549753) is 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide.
What is the SMILES notation for 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide?
The canonical SMILES for 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide is COc1ccnc(NNC(=O)CCCOc2cccc(F)c2)n1.
What is the InChIKey of 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide?
The InChIKey is PWGYGVNSSZSPOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17FN4O3/c1-22-14-7-8-17-15(18-14)20-19-13(21)6-3-9-23-12-5-2-4-11(16)10-12/h2,4-5,7-8,10H,3,6,9H2,1H3,(H,19,21)(H,17,18,20).
What are the key properties of 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide?
4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide has a molecular weight of 320.32 g/mol, XLogP of 1.93, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluorophenoxy)-N'-(4-methoxypyrimidin-2-yl)butanehydrazide is sourced from PubChem (CID 60549753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).