C16H11F3O4 — CID 6055007
6-methyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]pyran-2,4-dione (PubChem CID 6055007) has the molecular formula C16H11F3O4 and a molecular weight of 324.25 g/mol. Its IUPAC name is 6-methyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]pyran-2,4-dione.
| Compound Name | 6-methyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]pyran-2,4-dione |
|---|---|
| PubChem CID | 6055007 |
| Molecular Formula | C16H11F3O4 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 6-methyl-3-[(E)-3-[4-(trifluoromethyl)phenyl]prop-2-enoyl]pyran-2,4-dione |
| SMILES | CC1=CC(=O)C(C(=O)/C=C/c2ccc(C(F)(F)F)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H11F3O4/c1-9-8-13(21)14(15(22)23-9)12(20)7-4-10-2-5-11(6-3-10)16(17,18)19/h2-8,14H,1H3/b7-4+ |
| InChIKey | OHPOLBOEFGPUBF-QPJJXVBHSA-N |
| XLogP | 2.93 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|