C23H23ClN4O3 — CID 60550194
[2-[(4-chlorophenyl)methoxy]phenyl]-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone (PubChem CID 60550194) has the molecular formula C23H23ClN4O3 and a molecular weight of 438.92 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methoxy]phenyl]-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone.
| Compound Name | [2-[(4-chlorophenyl)methoxy]phenyl]-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60550194 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | [2-[(4-chlorophenyl)methoxy]phenyl]-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]methanone |
| SMILES | COc1ccnc(N2CCN(C(=O)c3ccccc3OCc3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C23H23ClN4O3/c1-30-21-10-11-25-23(26-21)28-14-12-27(13-15-28)22(29)19-4-2-3-5-20(19)31-16-17-6-8-18(24)9-7-17/h2-11H,12-16H2,1H3 |
| InChIKey | ITYMONBTOCPXFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |