C23H40O7 — CID 6055165
methyl (2E,4E)-8-[6-(2,2-dimethoxyethyl)-4-hydroxy-3,5-dimethyloxan-2-yl]-7-hydroxy-2,6-dimethylnona-2,4-dienoate (PubChem CID 6055165) has the molecular formula C23H40O7 and a molecular weight of 428.57 g/mol. Its IUPAC name is methyl (2E,4E)-8-[6-(2,2-dimethoxyethyl)-4-hydroxy-3,5-dimethyloxan-2-yl]-7-hydroxy-2,6-dimethylnona-2,4-dienoate.
| Compound Name | methyl (2E,4E)-8-[6-(2,2-dimethoxyethyl)-4-hydroxy-3,5-dimethyloxan-2-yl]-7-hydroxy-2,6-dimethylnona-2,4-dienoate |
|---|---|
| PubChem CID | 6055165 |
| Molecular Formula | C23H40O7 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | methyl (2E,4E)-8-[6-(2,2-dimethoxyethyl)-4-hydroxy-3,5-dimethyloxan-2-yl]-7-hydroxy-2,6-dimethylnona-2,4-dienoate |
| SMILES | COC(=O)/C(C)=C/C=C/C(C)C(O)C(C)C1OC(CC(OC)OC)C(C)C(O)C1C |
| InChI | InChI=1S/C23H40O7/c1-13(10-9-11-14(2)23(26)29-8)20(24)16(4)22-17(5)21(25)15(3)18(30-22)12-19(27-6)28-7/h9-11,13,15-22,24-25H,12H2,1-8H3/b10-9+,14-11+ |
| InChIKey | IUPRBAQOWNNLEG-QDCWQMMGSA-N |
| XLogP | 2.70 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|