About 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile
2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile (PubChem CID 60552991) has the molecular formula C13H12N2OS2
and a molecular weight of 276.39 g/mol. Its IUPAC name is 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile.
Molecular Properties
| Compound Name | 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile |
| PubChem CID | 60552991 |
| Molecular Formula | C13H12N2OS2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(OCCSc2nccs2)cc1 |
| InChI | InChI=1S/C13H12N2OS2/c14-6-5-11-1-3-12(4-2-11)16-8-10-18-13-15-7-9-17-13/h1-4,7,9H,5,8,10H2 |
| InChIKey | IBKKMBGSOBYWTC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile?
The IUPAC name of 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile (CID 60552991) is 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile.
What is the SMILES notation for 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile?
The canonical SMILES for 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile is N#CCc1ccc(OCCSc2nccs2)cc1.
What is the InChIKey of 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile?
The InChIKey is IBKKMBGSOBYWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2OS2/c14-6-5-11-1-3-12(4-2-11)16-8-10-18-13-15-7-9-17-13/h1-4,7,9H,5,8,10H2.
What are the key properties of 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile?
2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile has a molecular weight of 276.39 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(1,3-thiazol-2-ylsulfanyl)ethoxy]phenyl]acetonitrile is sourced from PubChem (CID 60552991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).