C28H25N3O3S — CID 60553589
3-(1,3-benzothiazol-2-yl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-methyl-2-phenylpropanamide (PubChem CID 60553589) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-methyl-2-phenylpropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 60553589 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[4-(2,6-dioxopiperidin-1-yl)phenyl]-2-methyl-2-phenylpropanamide |
| SMILES | CC(Cc1nc2ccccc2s1)(C(=O)Nc1ccc(N2C(=O)CCCC2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H25N3O3S/c1-28(19-8-3-2-4-9-19,18-24-30-22-10-5-6-11-23(22)35-24)27(34)29-20-14-16-21(17-15-20)31-25(32)12-7-13-26(31)33/h2-6,8-11,14-17H,7,12-13,18H2,1H3,(H,29,34) |
| InChIKey | BLRMOHNERZBAIB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|