C23H23NO3S — CID 60553593
N-[(4-methylsulfonylphenyl)methyl]-2-(2-phenylethyl)benzamide (PubChem CID 60553593) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-[(4-methylsulfonylphenyl)methyl]-2-(2-phenylethyl)benzamide.
| Compound Name | N-[(4-methylsulfonylphenyl)methyl]-2-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 60553593 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-[(4-methylsulfonylphenyl)methyl]-2-(2-phenylethyl)benzamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)c2ccccc2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-28(26,27)21-15-12-19(13-16-21)17-24-23(25)22-10-6-5-9-20(22)14-11-18-7-3-2-4-8-18/h2-10,12-13,15-16H,11,14,17H2,1H3,(H,24,25) |
| InChIKey | ZBPNLGKGWHMIQQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |