C26H32N4O3 — CID 60553736
2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]butanamide (PubChem CID 60553736) has the molecular formula C26H32N4O3 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]butanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 60553736 |
| Molecular Formula | C26H32N4O3 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[2-(4-phenylpiperazin-1-yl)propyl]butanamide |
| SMILES | CC(C)C(C(=O)NCC(C)N1CCN(c2ccccc2)CC1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H32N4O3/c1-18(2)23(30-25(32)21-11-7-8-12-22(21)26(30)33)24(31)27-17-19(3)28-13-15-29(16-14-28)20-9-5-4-6-10-20/h4-12,18-19,23H,13-17H2,1-3H3,(H,27,31) |
| InChIKey | WTYJPTUEAUCLQM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|