C25H22N2O3 — CID 60553799
4-oxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-quinoline-3-carboxamide (PubChem CID 60553799) has the molecular formula C25H22N2O3 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-oxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-quinoline-3-carboxamide.
| Compound Name | 4-oxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 60553799 |
| Molecular Formula | C25H22N2O3 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 4-oxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCc1ccc(COCc2ccccc2)cc1)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C25H22N2O3/c28-24-21-8-4-5-9-23(21)26-15-22(24)25(29)27-14-18-10-12-20(13-11-18)17-30-16-19-6-2-1-3-7-19/h1-13,15H,14,16-17H2,(H,26,28)(H,27,29) |
| InChIKey | AJBCTWQTMUMQMR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |