C19H26ClN5O3 — CID 60554213
1-[3-chloro-4-(2-methoxyethoxy)phenyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea (PubChem CID 60554213) has the molecular formula C19H26ClN5O3 and a molecular weight of 407.90 g/mol. Its IUPAC name is 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea.
| Compound Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 60554213 |
| Molecular Formula | C19H26ClN5O3 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 1-[3-chloro-4-(2-methoxyethoxy)phenyl]-3-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethyl]urea |
| SMILES | COCCOc1ccc(NC(=O)NCCc2nnc3n2CCCCC3)cc1Cl |
| InChI | InChI=1S/C19H26ClN5O3/c1-27-11-12-28-16-7-6-14(13-15(16)20)22-19(26)21-9-8-18-24-23-17-5-3-2-4-10-25(17)18/h6-7,13H,2-5,8-12H2,1H3,(H2,21,22,26) |
| InChIKey | DXCFKGJPXMXLIH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|