C24H28N4O4 — CID 60555570
N-[(3-butoxyphenyl)methyl]-7-cyclopropyl-1-ethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide (PubChem CID 60555570) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is N-[(3-butoxyphenyl)methyl]-7-cyclopropyl-1-ethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[(3-butoxyphenyl)methyl]-7-cyclopropyl-1-ethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 60555570 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[(3-butoxyphenyl)methyl]-7-cyclopropyl-1-ethyl-2,4-dioxopyrido[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCCCOc1cccc(CNC(=O)c2cc(C3CC3)nc3c2c(=O)[nH]c(=O)n3CC)c1 |
| InChI | InChI=1S/C24H28N4O4/c1-3-5-11-32-17-8-6-7-15(12-17)14-25-22(29)18-13-19(16-9-10-16)26-21-20(18)23(30)27-24(31)28(21)4-2/h6-8,12-13,16H,3-5,9-11,14H2,1-2H3,(H,25,29)(H,27,30,31) |
| InChIKey | UEXAEVBCUICSDN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|