C24H24FN3O4 — CID 60555908
methyl 2-[[2-[4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]phenyl]acetyl]amino]acetate (PubChem CID 60555908) has the molecular formula C24H24FN3O4 and a molecular weight of 437.47 g/mol. Its IUPAC name is methyl 2-[[2-[4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 60555908 |
| Molecular Formula | C24H24FN3O4 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | methyl 2-[[2-[4-[[1-(4-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]amino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)c2cc(C)n(-c3ccc(F)cc3)c2C)cc1 |
| InChI | InChI=1S/C24H24FN3O4/c1-15-12-21(16(2)28(15)20-10-6-18(25)7-11-20)24(31)27-19-8-4-17(5-9-19)13-22(29)26-14-23(30)32-3/h4-12H,13-14H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | DVKARPLTYXEYCO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|