C21H29N3O3S — CID 60556699
5-(diethylsulfamoyl)-2-methyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 60556699) has the molecular formula C21H29N3O3S and a molecular weight of 403.55 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-methyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-methyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 60556699 |
| Molecular Formula | C21H29N3O3S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-methyl-N-propan-2-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(C(=O)N(Cc2cccnc2)C(C)C)c1 |
| InChI | InChI=1S/C21H29N3O3S/c1-6-23(7-2)28(26,27)19-11-10-17(5)20(13-19)21(25)24(16(3)4)15-18-9-8-12-22-14-18/h8-14,16H,6-7,15H2,1-5H3 |
| InChIKey | ILHYRQIEWTWRFM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |